About ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+)
ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+) (PubChem CID 143722591) has the molecular formula C7H12N3ORb
and a molecular weight of 239.66 g/mol. Its IUPAC name is ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+).
Molecular Properties
| Compound Name | ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+) |
| PubChem CID | 143722591 |
| Molecular Formula | C7H12N3ORb |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+) |
| SMILES | CC.CNc1cnc[n-]c1=O.[Rb+] |
| InChI | InChI=1S/C5H7N3O.C2H6.Rb/c1-6-4-2-7-3-8-5(4)9;1-2;/h2-3,6H,1H3,(H,7,8,9);1-2H3;/q;;+1/p-1 |
| InChIKey | XFVZJCWRSWJTLI-UHFFFAOYSA-M |
| XLogP | -2.53 |
| TPSA | 56.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+)?
The IUPAC name of ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+) (CID 143722591) is ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+).
What is the SMILES notation for ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+)?
The canonical SMILES for ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+) is CC.CNc1cnc[n-]c1=O.[Rb+].
What is the InChIKey of ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+)?
The InChIKey is XFVZJCWRSWJTLI-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H7N3O.C2H6.Rb/c1-6-4-2-7-3-8-5(4)9;1-2;/h2-3,6H,1H3,(H,7,8,9);1-2H3;/q;;+1/p-1.
What are the key properties of ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+)?
ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+) has a molecular weight of 239.66 g/mol, XLogP of -2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-(methylamino)pyrimidin-3-id-4-one;rubidium(1+) is sourced from PubChem (CID 143722591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).