C14H23N3O — CID 143723489
4-(9-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-d]azepin-2-yl)morpholine (PubChem CID 143723489) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 4-(9-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-d]azepin-2-yl)morpholine.
| Compound Name | 4-(9-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-d]azepin-2-yl)morpholine |
|---|---|
| PubChem CID | 143723489 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 4-(9-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-d]azepin-2-yl)morpholine |
| SMILES | CC1CNCCC2=C1N=C(N1CCOCC1)CC2 |
| InChI | InChI=1S/C14H23N3O/c1-11-10-15-5-4-12-2-3-13(16-14(11)12)17-6-8-18-9-7-17/h11,15H,2-10H2,1H3 |
| InChIKey | CINBSVBHXCBUBZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |