C9H9FN2S — CID 143724154
5-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-1,3-thiazol-2-amine (PubChem CID 143724154) has the molecular formula C9H9FN2S and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 143724154 |
| Molecular Formula | C9H9FN2S |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 5-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-1,3-thiazol-2-amine |
| SMILES | C=C/C=C(\C(=C)F)c1cnc(N)s1 |
| InChI | InChI=1S/C9H9FN2S/c1-3-4-7(6(2)10)8-5-12-9(11)13-8/h3-5H,1-2H2,(H2,11,12)/b7-4+ |
| InChIKey | UKTDJDUTBRGLLE-QPJJXVBHSA-N |
| XLogP | 2.78 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|