C16H22NOP — CID 143724449
N-cyclohexyl-N-cyclopropyl-3-phosphanylbenzamide (PubChem CID 143724449) has the molecular formula C16H22NOP and a molecular weight of 275.33 g/mol. Its IUPAC name is N-cyclohexyl-N-cyclopropyl-3-phosphanylbenzamide.
| Compound Name | N-cyclohexyl-N-cyclopropyl-3-phosphanylbenzamide |
|---|---|
| PubChem CID | 143724449 |
| Molecular Formula | C16H22NOP |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-cyclohexyl-N-cyclopropyl-3-phosphanylbenzamide |
| SMILES | O=C(c1cccc(P)c1)N(C1CCCCC1)C1CC1 |
| InChI | InChI=1S/C16H22NOP/c18-16(12-5-4-8-15(19)11-12)17(14-9-10-14)13-6-2-1-3-7-13/h4-5,8,11,13-14H,1-3,6-7,9-10,19H2 |
| InChIKey | PBWUHGCJGIGJMM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|