C16H20N2O4S — CID 143724659
6-(1,1-dioxo-1,3-thiazolidin-3-yl)spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 143724659) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 6-(1,1-dioxo-1,3-thiazolidin-3-yl)spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-(1,1-dioxo-1,3-thiazolidin-3-yl)spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 143724659 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 6-(1,1-dioxo-1,3-thiazolidin-3-yl)spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | O=C1CC2(CCNCC2)Oc2ccc(N3CCS(=O)(=O)C3)cc21 |
| InChI | InChI=1S/C16H20N2O4S/c19-14-10-16(3-5-17-6-4-16)22-15-2-1-12(9-13(14)15)18-7-8-23(20,21)11-18/h1-2,9,17H,3-8,10-11H2 |
| InChIKey | BJSOXQIPSKNPAA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|