C20H27N3O2 — CID 143724925
(3-amino-2-pyridinyl)-(4-phenylpiperidin-1-yl)methanone;propan-1-ol (PubChem CID 143724925) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is (3-amino-2-pyridinyl)-(4-phenylpiperidin-1-yl)methanone;propan-1-ol.
| Compound Name | (3-amino-2-pyridinyl)-(4-phenylpiperidin-1-yl)methanone;propan-1-ol |
|---|---|
| PubChem CID | 143724925 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (3-amino-2-pyridinyl)-(4-phenylpiperidin-1-yl)methanone;propan-1-ol |
| SMILES | CCCO.Nc1cccnc1C(=O)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H19N3O.C3H8O/c18-15-7-4-10-19-16(15)17(21)20-11-8-14(9-12-20)13-5-2-1-3-6-13;1-2-3-4/h1-7,10,14H,8-9,11-12,18H2;4H,2-3H2,1H3 |
| InChIKey | BXQKUCMKBRJTQU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |