C25H44N2 — CID 143726058
(2Z)-2-[3-[bis(2-ethylhexyl)amino]cyclohex-2-en-1-ylidene]propanenitrile (PubChem CID 143726058) has the molecular formula C25H44N2 and a molecular weight of 372.64 g/mol. Its IUPAC name is (2Z)-2-[3-[bis(2-ethylhexyl)amino]cyclohex-2-en-1-ylidene]propanenitrile.
| Compound Name | (2Z)-2-[3-[bis(2-ethylhexyl)amino]cyclohex-2-en-1-ylidene]propanenitrile |
|---|---|
| PubChem CID | 143726058 |
| Molecular Formula | C25H44N2 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.35 |
| IUPAC Name | (2Z)-2-[3-[bis(2-ethylhexyl)amino]cyclohex-2-en-1-ylidene]propanenitrile |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C1=C/C(=C(/C)C#N)CCC1 |
| InChI | InChI=1S/C25H44N2/c1-6-10-13-22(8-3)19-27(20-23(9-4)14-11-7-2)25-16-12-15-24(17-25)21(5)18-26/h17,22-23H,6-16,19-20H2,1-5H3/b24-21- |
| InChIKey | WOVZCISYAVKFGN-FLFQWRMESA-N |
| XLogP | 7.63 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|