C20H15F3N2O2S — CID 143726685
N-[(Z)-1-(1-benzothiophen-2-ylmethoxy)-2-(methylideneamino)-2-phenylethenyl]-2,2,2-trifluoroacetamide (PubChem CID 143726685) has the molecular formula C20H15F3N2O2S and a molecular weight of 404.41 g/mol. Its IUPAC name is N-[(Z)-1-(1-benzothiophen-2-ylmethoxy)-2-(methylideneamino)-2-phenylethenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(Z)-1-(1-benzothiophen-2-ylmethoxy)-2-(methylideneamino)-2-phenylethenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 143726685 |
| Molecular Formula | C20H15F3N2O2S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | N-[(Z)-1-(1-benzothiophen-2-ylmethoxy)-2-(methylideneamino)-2-phenylethenyl]-2,2,2-trifluoroacetamide |
| SMILES | C=N/C(=C(/NC(=O)C(F)(F)F)OCc1cc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C20H15F3N2O2S/c1-24-17(13-7-3-2-4-8-13)18(25-19(26)20(21,22)23)27-12-15-11-14-9-5-6-10-16(14)28-15/h2-11H,1,12H2,(H,25,26)/b18-17- |
| InChIKey | DSQOMDLURXIWOV-ZCXUNETKSA-N |
| XLogP | 5.12 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|