About 2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine
2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine (PubChem CID 143726717) has the molecular formula C24H23ClN2O2
and a molecular weight of 406.91 g/mol. Its IUPAC name is 2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine.
Molecular Properties
| Compound Name | 2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine |
| PubChem CID | 143726717 |
| Molecular Formula | C24H23ClN2O2 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine |
| SMILES | C=NC.O=C(N/C(=C\c1ccccc1)OCc1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C22H18ClNO2.C2H5N/c23-20-14-8-7-13-19(20)22(25)24-21(15-17-9-3-1-4-10-17)26-16-18-11-5-2-6-12-18;1-3-2/h1-15H,16H2,(H,24,25);1H2,2H3/b21-15+; |
| InChIKey | BMOOOBLVZYPREK-NEMIEIFKSA-N |
| XLogP | 5.60 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine?
The IUPAC name of 2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine (CID 143726717) is 2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine.
What is the SMILES notation for 2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine?
The canonical SMILES for 2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine is C=NC.O=C(N/C(=C\c1ccccc1)OCc1ccccc1)c1ccccc1Cl.
What is the InChIKey of 2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine?
The InChIKey is BMOOOBLVZYPREK-NEMIEIFKSA-N. The full InChI is InChI=1S/C22H18ClNO2.C2H5N/c23-20-14-8-7-13-19(20)22(25)24-21(15-17-9-3-1-4-10-17)26-16-18-11-5-2-6-12-18;1-3-2/h1-15H,16H2,(H,24,25);1H2,2H3/b21-15+;.
What are the key properties of 2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine?
2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine has a molecular weight of 406.91 g/mol, XLogP of 5.60, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(E)-2-phenyl-1-phenylmethoxyethenyl]benzamide;N-methylmethanimine is sourced from PubChem (CID 143726717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).