C20H26N2O2 — CID 143726791
2-[6-(methylamino)heptyl]-3a,9b-dihydrobenzo[de]isoquinoline-1,3-dione (PubChem CID 143726791) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-[6-(methylamino)heptyl]-3a,9b-dihydrobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[6-(methylamino)heptyl]-3a,9b-dihydrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 143726791 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2-[6-(methylamino)heptyl]-3a,9b-dihydrobenzo[de]isoquinoline-1,3-dione |
| SMILES | CNC(C)CCCCCN1C(=O)C2=CC=CC3=CC=CC(C1=O)C32 |
| InChI | InChI=1S/C20H26N2O2/c1-14(21-2)8-4-3-5-13-22-19(23)16-11-6-9-15-10-7-12-17(18(15)16)20(22)24/h6-7,9-12,14,16,18,21H,3-5,8,13H2,1-2H3 |
| InChIKey | OCIUHGXWCOHDGC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|