C16H25N3O3 — CID 143727448
N-[(E)-[(2E,3Z)-2-ethylidenehexa-3,5-dienylidene]amino]-N'-hydroxyoctanediamide (PubChem CID 143727448) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-[(E)-[(2E,3Z)-2-ethylidenehexa-3,5-dienylidene]amino]-N'-hydroxyoctanediamide.
| Compound Name | N-[(E)-[(2E,3Z)-2-ethylidenehexa-3,5-dienylidene]amino]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 143727448 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N-[(E)-[(2E,3Z)-2-ethylidenehexa-3,5-dienylidene]amino]-N'-hydroxyoctanediamide |
| SMILES | C=C/C=C\C(\C=N\NC(=O)CCCCCCC(=O)NO)=C/C |
| InChI | InChI=1S/C16H25N3O3/c1-3-5-10-14(4-2)13-17-18-15(20)11-8-6-7-9-12-16(21)19-22/h3-5,10,13,22H,1,6-9,11-12H2,2H3,(H,18,20)(H,19,21)/b10-5-,14-4+,17-13+ |
| InChIKey | RYIJLFQBROABRW-HKEDMDPISA-N |
| XLogP | 2.62 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|