C17H24O2 — CID 143728027
(1R,2S,4S)-4-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)cyclopentan-1-ol (PubChem CID 143728027) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (1R,2S,4S)-4-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)cyclopentan-1-ol.
| Compound Name | (1R,2S,4S)-4-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 143728027 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (1R,2S,4S)-4-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)cyclopentan-1-ol |
| SMILES | C[C@H]1C[C@@H](COc2ccc3c(c2)CCCC3)[C@H](O)C1 |
| InChI | InChI=1S/C17H24O2/c1-12-8-15(17(18)9-12)11-19-16-7-6-13-4-2-3-5-14(13)10-16/h6-7,10,12,15,17-18H,2-5,8-9,11H2,1H3/t12-,15-,17+/m0/s1 |
| InChIKey | TXNXJWPSVGHKMU-YLQAJVPDSA-N |
| XLogP | 3.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |