C12H16N2O — CID 14372826
3,4,6,7,8,9-hexahydro-2H-pyrano[2,3-b]quinolin-5-amine (PubChem CID 14372826) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 3,4,6,7,8,9-hexahydro-2H-pyrano[2,3-b]quinolin-5-amine.
| Compound Name | 3,4,6,7,8,9-hexahydro-2H-pyrano[2,3-b]quinolin-5-amine |
|---|---|
| PubChem CID | 14372826 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3,4,6,7,8,9-hexahydro-2H-pyrano[2,3-b]quinolin-5-amine |
| SMILES | Nc1c2c(nc3c1CCCO3)CCCC2 |
| InChI | InChI=1S/C12H16N2O/c13-11-8-4-1-2-6-10(8)14-12-9(11)5-3-7-15-12/h1-7H2,(H2,13,14) |
| InChIKey | ZPEZHGZYZCQFAI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |