C18H16Cl2FN5 — CID 143728677
5-chloro-6-(2-chloro-6-fluorophenyl)-7-(4-ethenylpiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 143728677) has the molecular formula C18H16Cl2FN5 and a molecular weight of 392.27 g/mol. Its IUPAC name is 5-chloro-6-(2-chloro-6-fluorophenyl)-7-(4-ethenylpiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5-chloro-6-(2-chloro-6-fluorophenyl)-7-(4-ethenylpiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 143728677 |
| Molecular Formula | C18H16Cl2FN5 |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 5-chloro-6-(2-chloro-6-fluorophenyl)-7-(4-ethenylpiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | C=CC1CCN(c2c(-c3c(F)cccc3Cl)c(Cl)nc3ncnn23)CC1 |
| InChI | InChI=1S/C18H16Cl2FN5/c1-2-11-6-8-25(9-7-11)17-15(14-12(19)4-3-5-13(14)21)16(20)24-18-22-10-23-26(17)18/h2-5,10-11H,1,6-9H2 |
| InChIKey | FZVQCERCCSSQQW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|