About (4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole
(4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole (PubChem CID 143728817) has the molecular formula C13H15F2NO
and a molecular weight of 239.26 g/mol. Its IUPAC name is (4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole.
Molecular Properties
| Compound Name | (4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole |
| PubChem CID | 143728817 |
| Molecular Formula | C13H15F2NO |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole |
| SMILES | CCCC1=N[C@](C)(c2ccc(F)c(F)c2)CO1 |
| InChI | InChI=1S/C13H15F2NO/c1-3-4-12-16-13(2,8-17-12)9-5-6-10(14)11(15)7-9/h5-7H,3-4,8H2,1-2H3/t13-/m0/s1 |
| InChIKey | GNZKJKNCJMGKCV-ZDUSSCGKSA-N |
| XLogP | 3.41 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole?
The IUPAC name of (4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole (CID 143728817) is (4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole.
What is the SMILES notation for (4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole?
The canonical SMILES for (4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole is CCCC1=N[C@](C)(c2ccc(F)c(F)c2)CO1.
What is the InChIKey of (4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole?
The InChIKey is GNZKJKNCJMGKCV-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H15F2NO/c1-3-4-12-16-13(2,8-17-12)9-5-6-10(14)11(15)7-9/h5-7H,3-4,8H2,1-2H3/t13-/m0/s1.
What are the key properties of (4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole?
(4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole has a molecular weight of 239.26 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(3,4-difluorophenyl)-4-methyl-2-propyl-5H-1,3-oxazole is sourced from PubChem (CID 143728817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).