About benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane
benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane (PubChem CID 143729119) has the molecular formula C21H30N2O3
and a molecular weight of 358.48 g/mol. Its IUPAC name is benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane.
Molecular Properties
| Compound Name | benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane |
| PubChem CID | 143729119 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane |
| SMILES | CCC.COc1c(C)cnc(CNCC(=O)OCc2ccccc2)c1C |
| InChI | InChI=1S/C18H22N2O3.C3H8/c1-13-9-20-16(14(2)18(13)22-3)10-19-11-17(21)23-12-15-7-5-4-6-8-15;1-3-2/h4-9,19H,10-12H2,1-3H3;3H2,1-2H3 |
| InChIKey | FGIJWGOHDWXTDW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane?
The IUPAC name of benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane (CID 143729119) is benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane.
What is the SMILES notation for benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane?
The canonical SMILES for benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane is CCC.COc1c(C)cnc(CNCC(=O)OCc2ccccc2)c1C.
What is the InChIKey of benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane?
The InChIKey is FGIJWGOHDWXTDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O3.C3H8/c1-13-9-20-16(14(2)18(13)22-3)10-19-11-17(21)23-12-15-7-5-4-6-8-15;1-3-2/h4-9,19H,10-12H2,1-3H3;3H2,1-2H3.
What are the key properties of benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane?
benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane has a molecular weight of 358.48 g/mol, XLogP of 3.96, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylamino]acetate;propane is sourced from PubChem (CID 143729119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).