About 5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine
5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine (PubChem CID 143729372) has the molecular formula C21H15F3N4OS
and a molecular weight of 428.44 g/mol. Its IUPAC name is 5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine |
| PubChem CID | 143729372 |
| Molecular Formula | C21H15F3N4OS |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine |
| SMILES | FC(F)(F)c1ccc(Nc2nnc(-c3ccccc3OCc3ccncc3)s2)cc1 |
| InChI | InChI=1S/C21H15F3N4OS/c22-21(23,24)15-5-7-16(8-6-15)26-20-28-27-19(30-20)17-3-1-2-4-18(17)29-13-14-9-11-25-12-10-14/h1-12H,13H2,(H,26,28) |
| InChIKey | VXDUCEZHKMOUEH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine (CID 143729372) is 5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine is FC(F)(F)c1ccc(Nc2nnc(-c3ccccc3OCc3ccncc3)s2)cc1.
What is the InChIKey of 5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine?
The InChIKey is VXDUCEZHKMOUEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F3N4OS/c22-21(23,24)15-5-7-16(8-6-15)26-20-28-27-19(30-20)17-3-1-2-4-18(17)29-13-14-9-11-25-12-10-14/h1-12H,13H2,(H,26,28).
What are the key properties of 5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine?
5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine has a molecular weight of 428.44 g/mol, XLogP of 5.94, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(pyridin-4-ylmethoxy)phenyl]-N-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 143729372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).