About ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate
ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate (PubChem CID 14372941) has the molecular formula C26H23N3O5
and a molecular weight of 457.49 g/mol. Its IUPAC name is ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate |
| PubChem CID | 14372941 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ncc3[nH]c4ccc(OCc5ccccc5)cc4c3c2COC)no1 |
| InChI | InChI=1S/C26H23N3O5/c1-3-32-26(30)23-12-21(29-34-23)25-19(15-31-2)24-18-11-17(33-14-16-7-5-4-6-8-16)9-10-20(18)28-22(24)13-27-25/h4-13,28H,3,14-15H2,1-2H3 |
| InChIKey | YYUQMDZXEUEYDD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate?
The IUPAC name of ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate (CID 14372941) is ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate?
The canonical SMILES for ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate is CCOC(=O)c1cc(-c2ncc3[nH]c4ccc(OCc5ccccc5)cc4c3c2COC)no1.
What is the InChIKey of ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate?
The InChIKey is YYUQMDZXEUEYDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23N3O5/c1-3-32-26(30)23-12-21(29-34-23)25-19(15-31-2)24-18-11-17(33-14-16-7-5-4-6-8-16)9-10-20(18)28-22(24)13-27-25/h4-13,28H,3,14-15H2,1-2H3.
What are the key properties of ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate?
ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate has a molecular weight of 457.49 g/mol, XLogP of 5.27, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[4-(methoxymethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indol-3-yl]-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 14372941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).