About 5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide
5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide (PubChem CID 143729447) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide.
Molecular Properties
| Compound Name | 5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide |
| PubChem CID | 143729447 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide |
| SMILES | COCC1CC=CC(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C11H19NO2/c1-12(2)11(13)10-6-4-5-9(7-10)8-14-3/h4,6,9-10H,5,7-8H2,1-3H3 |
| InChIKey | NXBMLZPNBYEDGW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide?
The IUPAC name of 5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide (CID 143729447) is 5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide.
What is the SMILES notation for 5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide?
The canonical SMILES for 5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide is COCC1CC=CC(C(=O)N(C)C)C1.
What is the InChIKey of 5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide?
The InChIKey is NXBMLZPNBYEDGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-12(2)11(13)10-6-4-5-9(7-10)8-14-3/h4,6,9-10H,5,7-8H2,1-3H3.
What are the key properties of 5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide?
5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide has a molecular weight of 197.28 g/mol, XLogP of 1.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-N,N-dimethylcyclohex-2-ene-1-carboxamide is sourced from PubChem (CID 143729447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).