C25H42N2O3 — CID 143729748
tert-butyl (2R)-2-[2-[cyclopropyl(methyl)amino]ethyl]-5-methylpiperidine-1-carboxylate;(4Z)-3-methylidenehepta-4,6-dienal (PubChem CID 143729748) has the molecular formula C25H42N2O3 and a molecular weight of 418.62 g/mol. Its IUPAC name is tert-butyl (2R)-2-[2-[cyclopropyl(methyl)amino]ethyl]-5-methylpiperidine-1-carboxylate;(4Z)-3-methylidenehepta-4,6-dienal.
| Compound Name | tert-butyl (2R)-2-[2-[cyclopropyl(methyl)amino]ethyl]-5-methylpiperidine-1-carboxylate;(4Z)-3-methylidenehepta-4,6-dienal |
|---|---|
| PubChem CID | 143729748 |
| Molecular Formula | C25H42N2O3 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.32 |
| IUPAC Name | tert-butyl (2R)-2-[2-[cyclopropyl(methyl)amino]ethyl]-5-methylpiperidine-1-carboxylate;(4Z)-3-methylidenehepta-4,6-dienal |
| SMILES | C=C/C=C\C(=C)CC=O.CC1CC[C@H](CCN(C)C2CC2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H32N2O2.C8H10O/c1-13-6-7-15(10-11-18(5)14-8-9-14)19(12-13)16(20)21-17(2,3)4;1-3-4-5-8(2)6-7-9/h13-15H,6-12H2,1-5H3;3-5,7H,1-2,6H2/b;5-4-/t13?,15-;/m1./s1 |
| InChIKey | DRHNNVQUAFZCJD-ABWBNSIKSA-N |
| XLogP | 5.38 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|