C21H27F2N5O3 — CID 143729983
(2S)-1-[(3S)-3-amino-4-(5,5-difluoro-2-oxopiperidin-1-yl)butanoyl]-N-[amino(phenyl)methylidene]pyrrolidine-2-carboxamide (PubChem CID 143729983) has the molecular formula C21H27F2N5O3 and a molecular weight of 435.48 g/mol. Its IUPAC name is (2S)-1-[(3S)-3-amino-4-(5,5-difluoro-2-oxopiperidin-1-yl)butanoyl]-N-[amino(phenyl)methylidene]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(3S)-3-amino-4-(5,5-difluoro-2-oxopiperidin-1-yl)butanoyl]-N-[amino(phenyl)methylidene]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143729983 |
| Molecular Formula | C21H27F2N5O3 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | (2S)-1-[(3S)-3-amino-4-(5,5-difluoro-2-oxopiperidin-1-yl)butanoyl]-N-[amino(phenyl)methylidene]pyrrolidine-2-carboxamide |
| SMILES | N/C(=N\C(=O)[C@@H]1CCCN1C(=O)C[C@H](N)CN1CC(F)(F)CCC1=O)c1ccccc1 |
| InChI | InChI=1S/C21H27F2N5O3/c22-21(23)9-8-17(29)27(13-21)12-15(24)11-18(30)28-10-4-7-16(28)20(31)26-19(25)14-5-2-1-3-6-14/h1-3,5-6,15-16H,4,7-13,24H2,(H2,25,26,31)/t15-,16-/m0/s1 |
| InChIKey | SZILFSCRVWFORU-HOTGVXAUSA-N |
| XLogP | 0.88 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|