About 2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane
2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane (PubChem CID 143730738) has the molecular formula C15H28N2
and a molecular weight of 236.40 g/mol. Its IUPAC name is 2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane.
Molecular Properties
| Compound Name | 2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane |
| PubChem CID | 143730738 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane |
| SMILES | CC.CCN1CCCN=C1CCC1=C(C)C1C |
| InChI | InChI=1S/C13H22N2.C2H6/c1-4-15-9-5-8-14-13(15)7-6-12-10(2)11(12)3;1-2/h10H,4-9H2,1-3H3;1-2H3 |
| InChIKey | APZANLCZUHEWLG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane?
The IUPAC name of 2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane (CID 143730738) is 2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane.
What is the SMILES notation for 2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane?
The canonical SMILES for 2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane is CC.CCN1CCCN=C1CCC1=C(C)C1C.
What is the InChIKey of 2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane?
The InChIKey is APZANLCZUHEWLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2.C2H6/c1-4-15-9-5-8-14-13(15)7-6-12-10(2)11(12)3;1-2/h10H,4-9H2,1-3H3;1-2H3.
What are the key properties of 2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane?
2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane has a molecular weight of 236.40 g/mol, XLogP of 3.88, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,3-dimethylcyclopropen-1-yl)ethyl]-1-ethyl-5,6-dihydro-4H-pyrimidine;ethane is sourced from PubChem (CID 143730738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).