C19H29NO — CID 143731068
ethene;(E)-2-ethenylbut-2-en-1-amine;5-methoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 143731068) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is ethene;(E)-2-ethenylbut-2-en-1-amine;5-methoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | ethene;(E)-2-ethenylbut-2-en-1-amine;5-methoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 143731068 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | ethene;(E)-2-ethenylbut-2-en-1-amine;5-methoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=C.C=C/C(=C\C)CN.COc1cccc2c1CCCC2 |
| InChI | InChI=1S/C11H14O.C6H11N.C2H4/c1-12-11-8-4-6-9-5-2-3-7-10(9)11;1-3-6(4-2)5-7;1-2/h4,6,8H,2-3,5,7H2,1H3;3-4H,1,5,7H2,2H3;1-2H2/b;6-4+; |
| InChIKey | FFXFCARXMPKEPU-HWWUXOKASA-N |
| XLogP | 4.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|