C17H32BNO3 — CID 143731552
4-[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]morpholine;propane (PubChem CID 143731552) has the molecular formula C17H32BNO3 and a molecular weight of 309.26 g/mol. Its IUPAC name is 4-[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]morpholine;propane.
| Compound Name | 4-[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]morpholine;propane |
|---|---|
| PubChem CID | 143731552 |
| Molecular Formula | C17H32BNO3 |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 4-[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]morpholine;propane |
| SMILES | CC1(C)COB(C2=CCC(N3CCOCC3)CC2)O1.CCC |
| InChI | InChI=1S/C14H24BNO3.C3H8/c1-14(2)11-18-15(19-14)12-3-5-13(6-4-12)16-7-9-17-10-8-16;1-3-2/h3,13H,4-11H2,1-2H3;3H2,1-2H3 |
| InChIKey | NKYNPNQAIKPWSN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|