C18H35BO2 — CID 143731724
propane;4,4,5,5-tetramethyl-2-(3,3,5-trimethylcyclohexen-1-yl)-1,3,2-dioxaborolane (PubChem CID 143731724) has the molecular formula C18H35BO2 and a molecular weight of 294.29 g/mol. Its IUPAC name is propane;4,4,5,5-tetramethyl-2-(3,3,5-trimethylcyclohexen-1-yl)-1,3,2-dioxaborolane.
| Compound Name | propane;4,4,5,5-tetramethyl-2-(3,3,5-trimethylcyclohexen-1-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 143731724 |
| Molecular Formula | C18H35BO2 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | propane;4,4,5,5-tetramethyl-2-(3,3,5-trimethylcyclohexen-1-yl)-1,3,2-dioxaborolane |
| SMILES | CC1CC(B2OC(C)(C)C(C)(C)O2)=CC(C)(C)C1.CCC |
| InChI | InChI=1S/C15H27BO2.C3H8/c1-11-8-12(10-13(2,3)9-11)16-17-14(4,5)15(6,7)18-16;1-3-2/h10-11H,8-9H2,1-7H3;3H2,1-2H3 |
| InChIKey | JWEXEALZHQLANG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|