C27H34ClN2O3+ — CID 143732101
2-[(4-chlorophenyl)methoxy]ethyl-[[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl]-methylazanium (PubChem CID 143732101) has the molecular formula C27H34ClN2O3+ and a molecular weight of 470.03 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methoxy]ethyl-[[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl]-methylazanium.
| Compound Name | 2-[(4-chlorophenyl)methoxy]ethyl-[[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl]-methylazanium |
|---|---|
| PubChem CID | 143732101 |
| Molecular Formula | C27H34ClN2O3+ |
| Molecular Weight | 470.03 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 2-[(4-chlorophenyl)methoxy]ethyl-[[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl]-methylazanium |
| SMILES | C[NH+](CCOCc1ccc(Cl)cc1)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1 |
| InChI | InChI=1S/C27H33ClN2O3/c1-30(16-17-32-20-21-12-14-24(28)15-13-21)19-25-18-29-26(33-25)27(31,22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2,4-5,8-9,12-15,18,23,31H,3,6-7,10-11,16-17,19-20H2,1H3/p+1/t27-/m0/s1 |
| InChIKey | DVTFMSRFOBUQEC-MHZLTWQESA-O |
| XLogP | 4.38 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.03 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|