C9H9N2O2S- — CID 143732285
7-(2-aminoethyl)-2-oxo-3H-1,3-benzothiazol-4-olate (PubChem CID 143732285) has the molecular formula C9H9N2O2S- and a molecular weight of 209.25 g/mol. Its IUPAC name is 7-(2-aminoethyl)-2-oxo-3H-1,3-benzothiazol-4-olate.
| Compound Name | 7-(2-aminoethyl)-2-oxo-3H-1,3-benzothiazol-4-olate |
|---|---|
| PubChem CID | 143732285 |
| Molecular Formula | C9H9N2O2S- |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 7-(2-aminoethyl)-2-oxo-3H-1,3-benzothiazol-4-olate |
| SMILES | NCCc1ccc([O-])c2[nH]c(=O)sc12 |
| InChI | InChI=1S/C9H10N2O2S/c10-4-3-5-1-2-6(12)7-8(5)14-9(13)11-7/h1-2,12H,3-4,10H2,(H,11,13)/p-1 |
| InChIKey | YPLJLRNXOFWVTL-UHFFFAOYSA-M |
| XLogP | 0.16 |
| TPSA | 81.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |