About methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine
methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine (PubChem CID 143732942) has the molecular formula C19H22N2O2
and a molecular weight of 310.40 g/mol. Its IUPAC name is methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine.
Molecular Properties
| Compound Name | methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine |
| PubChem CID | 143732942 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine |
| SMILES | CN1CCCC1.COC(=O)c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C14H11NO2.C5H11N/c1-17-14(16)9-6-7-11-10-4-2-3-5-12(10)15-13(11)8-9;1-6-4-2-3-5-6/h2-8,15H,1H3;2-5H2,1H3 |
| InChIKey | DKJMBUHGUKIICZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine?
The IUPAC name of methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine (CID 143732942) is methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine.
What is the SMILES notation for methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine?
The canonical SMILES for methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine is CN1CCCC1.COC(=O)c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine?
The InChIKey is DKJMBUHGUKIICZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2.C5H11N/c1-17-14(16)9-6-7-11-10-4-2-3-5-12(10)15-13(11)8-9;1-6-4-2-3-5-6/h2-8,15H,1H3;2-5H2,1H3.
What are the key properties of methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine?
methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine has a molecular weight of 310.40 g/mol, XLogP of 3.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9H-carbazole-2-carboxylate;1-methylpyrrolidine is sourced from PubChem (CID 143732942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).