C28H33N3O5S — CID 143733036
(E)-1-[3-[4-[[1-azabicyclo[2.2.2]octan-4-ylmethoxy(cyclobutylidene)methyl]amino]-1,3-thiazol-5-yl]phenyl]pent-3-ene-1,2-dione;formic acid (PubChem CID 143733036) has the molecular formula C28H33N3O5S and a molecular weight of 523.66 g/mol. Its IUPAC name is (E)-1-[3-[4-[[1-azabicyclo[2.2.2]octan-4-ylmethoxy(cyclobutylidene)methyl]amino]-1,3-thiazol-5-yl]phenyl]pent-3-ene-1,2-dione;formic acid.
| Compound Name | (E)-1-[3-[4-[[1-azabicyclo[2.2.2]octan-4-ylmethoxy(cyclobutylidene)methyl]amino]-1,3-thiazol-5-yl]phenyl]pent-3-ene-1,2-dione;formic acid |
|---|---|
| PubChem CID | 143733036 |
| Molecular Formula | C28H33N3O5S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | (E)-1-[3-[4-[[1-azabicyclo[2.2.2]octan-4-ylmethoxy(cyclobutylidene)methyl]amino]-1,3-thiazol-5-yl]phenyl]pent-3-ene-1,2-dione;formic acid |
| SMILES | C/C=C/C(=O)C(=O)c1cccc(-c2scnc2NC(OCC23CCN(CC2)CC3)=C2CCC2)c1.O=CO |
| InChI | InChI=1S/C27H31N3O3S.CH2O2/c1-2-5-22(31)23(32)20-8-4-9-21(16-20)24-25(28-18-34-24)29-26(19-6-3-7-19)33-17-27-10-13-30(14-11-27)15-12-27;2-1-3/h2,4-5,8-9,16,18,29H,3,6-7,10-15,17H2,1H3;1H,(H,2,3)/b5-2+; |
| InChIKey | LLZRREGPPCFKNI-DPZBITMOSA-N |
| XLogP | 5.15 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|