C13H19N7O — CID 143734242
6-(2-aminopyrimidin-5-yl)-2-methyl-4-morpholin-4-yl-1H-pyrimidin-2-amine (PubChem CID 143734242) has the molecular formula C13H19N7O and a molecular weight of 289.34 g/mol. Its IUPAC name is 6-(2-aminopyrimidin-5-yl)-2-methyl-4-morpholin-4-yl-1H-pyrimidin-2-amine.
| Compound Name | 6-(2-aminopyrimidin-5-yl)-2-methyl-4-morpholin-4-yl-1H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 143734242 |
| Molecular Formula | C13H19N7O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 6-(2-aminopyrimidin-5-yl)-2-methyl-4-morpholin-4-yl-1H-pyrimidin-2-amine |
| SMILES | CC1(N)N=C(N2CCOCC2)C=C(c2cnc(N)nc2)N1 |
| InChI | InChI=1S/C13H19N7O/c1-13(15)18-10(9-7-16-12(14)17-8-9)6-11(19-13)20-2-4-21-5-3-20/h6-8,18H,2-5,15H2,1H3,(H2,14,16,17) |
| InChIKey | VFIRTRUIVLSJJR-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |