About N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide
N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide (PubChem CID 143734484) has the molecular formula C12H14Br2N4OS
and a molecular weight of 422.15 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide |
| PubChem CID | 143734484 |
| Molecular Formula | C12H14Br2N4OS |
| Molecular Weight | 422.15 g/mol |
| Exact Mass | 419.93 |
| IUPAC Name | N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide |
| SMILES | CC(CN)NC(=O)c1sc(-c2ccnn2C)c(Br)c1Br |
| InChI | InChI=1S/C12H14Br2N4OS/c1-6(5-15)17-12(19)11-9(14)8(13)10(20-11)7-3-4-16-18(7)2/h3-4,6H,5,15H2,1-2H3,(H,17,19) |
| InChIKey | GGVZTBCSYFQZJG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.15 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide?
The IUPAC name of N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide (CID 143734484) is N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide.
What is the SMILES notation for N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide?
The canonical SMILES for N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide is CC(CN)NC(=O)c1sc(-c2ccnn2C)c(Br)c1Br.
What is the InChIKey of N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide?
The InChIKey is GGVZTBCSYFQZJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Br2N4OS/c1-6(5-15)17-12(19)11-9(14)8(13)10(20-11)7-3-4-16-18(7)2/h3-4,6H,5,15H2,1-2H3,(H,17,19).
What are the key properties of N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide?
N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide has a molecular weight of 422.15 g/mol, XLogP of 2.75, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-aminopropan-2-yl)-3,4-dibromo-5-(2-methylpyrazol-3-yl)thiophene-2-carboxamide is sourced from PubChem (CID 143734484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).