C35H45NO4 — CID 143734909
methyl 4-[(E)-2-(4-tert-butylphenyl)-3-[[(2E,4E)-5-(cyclohexylmethoxy)hepta-2,4-dien-2-yl]amino]-3-oxoprop-1-enyl]benzoate (PubChem CID 143734909) has the molecular formula C35H45NO4 and a molecular weight of 543.75 g/mol. Its IUPAC name is methyl 4-[(E)-2-(4-tert-butylphenyl)-3-[[(2E,4E)-5-(cyclohexylmethoxy)hepta-2,4-dien-2-yl]amino]-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-2-(4-tert-butylphenyl)-3-[[(2E,4E)-5-(cyclohexylmethoxy)hepta-2,4-dien-2-yl]amino]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 143734909 |
| Molecular Formula | C35H45NO4 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | methyl 4-[(E)-2-(4-tert-butylphenyl)-3-[[(2E,4E)-5-(cyclohexylmethoxy)hepta-2,4-dien-2-yl]amino]-3-oxoprop-1-enyl]benzoate |
| SMILES | CC/C(=C\C=C(/C)NC(=O)/C(=C/c1ccc(C(=O)OC)cc1)c1ccc(C(C)(C)C)cc1)OCC1CCCCC1 |
| InChI | InChI=1S/C35H45NO4/c1-7-31(40-24-27-11-9-8-10-12-27)22-13-25(2)36-33(37)32(28-18-20-30(21-19-28)35(3,4)5)23-26-14-16-29(17-15-26)34(38)39-6/h13-23,27H,7-12,24H2,1-6H3,(H,36,37)/b25-13+,31-22+,32-23+ |
| InChIKey | OSIIBMNAHCFZRZ-VZLBMWHKSA-N |
| XLogP | 8.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|