C14H17ClN2O — CID 143735077
2-[1-(2-chloro-3-methylphenoxy)but-3-enyl]-4,5-dihydro-1H-imidazole (PubChem CID 143735077) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 2-[1-(2-chloro-3-methylphenoxy)but-3-enyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[1-(2-chloro-3-methylphenoxy)but-3-enyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 143735077 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-[1-(2-chloro-3-methylphenoxy)but-3-enyl]-4,5-dihydro-1H-imidazole |
| SMILES | C=CCC(Oc1cccc(C)c1Cl)C1=NCCN1 |
| InChI | InChI=1S/C14H17ClN2O/c1-3-5-12(14-16-8-9-17-14)18-11-7-4-6-10(2)13(11)15/h3-4,6-7,12H,1,5,8-9H2,2H3,(H,16,17) |
| InChIKey | QJCNPHIZNRBBKH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|