About N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline
N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline (PubChem CID 143735141) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline.
Molecular Properties
| Compound Name | N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline |
| PubChem CID | 143735141 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline |
| SMILES | CCN(C)c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C12H14N2O/c1-3-14(2)11-6-4-10(5-7-11)12-8-13-9-15-12/h4-9H,3H2,1-2H3 |
| InChIKey | XAUONFXQXRKVRT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline?
The IUPAC name of N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline (CID 143735141) is N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline.
What is the SMILES notation for N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline?
The canonical SMILES for N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline is CCN(C)c1ccc(-c2cnco2)cc1.
What is the InChIKey of N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline?
The InChIKey is XAUONFXQXRKVRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-3-14(2)11-6-4-10(5-7-11)12-8-13-9-15-12/h4-9H,3H2,1-2H3.
What are the key properties of N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline?
N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline has a molecular weight of 202.26 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methyl-4-(1,3-oxazol-5-yl)aniline is sourced from PubChem (CID 143735141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).