About 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol
2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol (PubChem CID 14373586) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol.
Molecular Properties
| Compound Name | 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol |
| PubChem CID | 14373586 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol |
| SMILES | OCCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C10H10N2O2/c13-7-6-9-11-10(12-14-9)8-4-2-1-3-5-8/h1-5,13H,6-7H2 |
| InChIKey | UBLQZDJTNFOEGS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol?
The IUPAC name of 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol (CID 14373586) is 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol.
What is the SMILES notation for 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol?
The canonical SMILES for 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol is OCCc1nc(-c2ccccc2)no1.
What is the InChIKey of 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol?
The InChIKey is UBLQZDJTNFOEGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c13-7-6-9-11-10(12-14-9)8-4-2-1-3-5-8/h1-5,13H,6-7H2.
What are the key properties of 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol?
2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol has a molecular weight of 190.20 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanol is sourced from PubChem (CID 14373586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).