C33H29ClFN3O4 — CID 143735877
[5-[4-(2-chlorophenoxy)-2-fluorophenyl]-10-hydroxy-2,2-dimethyl-1,3,5,11-tetrahydropyrano[2,3-c][1,5]benzodiazepin-6-yl]-(6-methyl-2-pyridinyl)methanone (PubChem CID 143735877) has the molecular formula C33H29ClFN3O4 and a molecular weight of 586.06 g/mol. Its IUPAC name is [5-[4-(2-chlorophenoxy)-2-fluorophenyl]-10-hydroxy-2,2-dimethyl-1,3,5,11-tetrahydropyrano[2,3-c][1,5]benzodiazepin-6-yl]-(6-methyl-2-pyridinyl)methanone.
| Compound Name | [5-[4-(2-chlorophenoxy)-2-fluorophenyl]-10-hydroxy-2,2-dimethyl-1,3,5,11-tetrahydropyrano[2,3-c][1,5]benzodiazepin-6-yl]-(6-methyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 143735877 |
| Molecular Formula | C33H29ClFN3O4 |
| Molecular Weight | 586.06 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | [5-[4-(2-chlorophenoxy)-2-fluorophenyl]-10-hydroxy-2,2-dimethyl-1,3,5,11-tetrahydropyrano[2,3-c][1,5]benzodiazepin-6-yl]-(6-methyl-2-pyridinyl)methanone |
| SMILES | Cc1cccc(C(=O)N2c3cccc(O)c3NC3=C(OCC(C)(C)C3)C2c2ccc(Oc3ccccc3Cl)cc2F)n1 |
| InChI | InChI=1S/C33H29ClFN3O4/c1-19-8-6-10-24(36-19)32(40)38-26-11-7-12-27(39)29(26)37-25-17-33(2,3)18-41-31(25)30(38)21-15-14-20(16-23(21)35)42-28-13-5-4-9-22(28)34/h4-16,30,37,39H,17-18H2,1-3H3 |
| InChIKey | MHQHFQSJUMFIQV-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.06 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|