C33H36FN3O5 — CID 143735930
[5-[4-(cyclohexen-1-ylmethoxy)-2-fluorophenyl]-10-hydroxy-2,2-dimethyl-1,3,5,11-tetrahydropyrano[2,3-c][1,5]benzodiazepin-6-yl]-(2,5-dimethyl-1,3-oxazol-4-yl)methanone (PubChem CID 143735930) has the molecular formula C33H36FN3O5 and a molecular weight of 573.67 g/mol. Its IUPAC name is [5-[4-(cyclohexen-1-ylmethoxy)-2-fluorophenyl]-10-hydroxy-2,2-dimethyl-1,3,5,11-tetrahydropyrano[2,3-c][1,5]benzodiazepin-6-yl]-(2,5-dimethyl-1,3-oxazol-4-yl)methanone.
| Compound Name | [5-[4-(cyclohexen-1-ylmethoxy)-2-fluorophenyl]-10-hydroxy-2,2-dimethyl-1,3,5,11-tetrahydropyrano[2,3-c][1,5]benzodiazepin-6-yl]-(2,5-dimethyl-1,3-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 143735930 |
| Molecular Formula | C33H36FN3O5 |
| Molecular Weight | 573.67 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | [5-[4-(cyclohexen-1-ylmethoxy)-2-fluorophenyl]-10-hydroxy-2,2-dimethyl-1,3,5,11-tetrahydropyrano[2,3-c][1,5]benzodiazepin-6-yl]-(2,5-dimethyl-1,3-oxazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)N2c3cccc(O)c3NC3=C(OCC(C)(C)C3)C2c2ccc(OCC3=CCCCC3)cc2F)c(C)o1 |
| InChI | InChI=1S/C33H36FN3O5/c1-19-28(35-20(2)42-19)32(39)37-26-11-8-12-27(38)29(26)36-25-16-33(3,4)18-41-31(25)30(37)23-14-13-22(15-24(23)34)40-17-21-9-6-5-7-10-21/h8-9,11-15,30,36,38H,5-7,10,16-18H2,1-4H3 |
| InChIKey | QHNLDPFOVVQAMT-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 97.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.67 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|