C30H32FN3O4S — CID 143735947
(2,5-dimethyl-1,3-oxazol-4-yl)-[5-[2-fluoro-4-(2-methylprop-2-enoxy)phenyl]-10-hydroxy-2,2-dimethyl-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone (PubChem CID 143735947) has the molecular formula C30H32FN3O4S and a molecular weight of 549.67 g/mol. Its IUPAC name is (2,5-dimethyl-1,3-oxazol-4-yl)-[5-[2-fluoro-4-(2-methylprop-2-enoxy)phenyl]-10-hydroxy-2,2-dimethyl-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone.
| Compound Name | (2,5-dimethyl-1,3-oxazol-4-yl)-[5-[2-fluoro-4-(2-methylprop-2-enoxy)phenyl]-10-hydroxy-2,2-dimethyl-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone |
|---|---|
| PubChem CID | 143735947 |
| Molecular Formula | C30H32FN3O4S |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | (2,5-dimethyl-1,3-oxazol-4-yl)-[5-[2-fluoro-4-(2-methylprop-2-enoxy)phenyl]-10-hydroxy-2,2-dimethyl-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone |
| SMILES | C=C(C)COc1ccc(C2C3=C(CC(C)(C)CS3)Nc3c(O)cccc3N2C(=O)c2nc(C)oc2C)c(F)c1 |
| InChI | InChI=1S/C30H32FN3O4S/c1-16(2)14-37-19-10-11-20(21(31)12-19)27-28-22(13-30(5,6)15-39-28)33-26-23(8-7-9-24(26)35)34(27)29(36)25-17(3)38-18(4)32-25/h7-12,27,33,35H,1,13-15H2,2-6H3 |
| InChIKey | KMWHCNPRUWSYIM-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|