C27H29ClN2O3S — CID 143736006
5-[2-chloro-4-(cyclohexa-1,5-dien-1-ylmethoxy)phenyl]-2,2-dimethyl-4-oxo-3,5,6,11-tetrahydro-1H-thiopyrano[2,3-c][1,5]benzodiazepin-10-ol (PubChem CID 143736006) has the molecular formula C27H29ClN2O3S and a molecular weight of 497.06 g/mol. Its IUPAC name is 5-[2-chloro-4-(cyclohexa-1,5-dien-1-ylmethoxy)phenyl]-2,2-dimethyl-4-oxo-3,5,6,11-tetrahydro-1H-thiopyrano[2,3-c][1,5]benzodiazepin-10-ol.
| Compound Name | 5-[2-chloro-4-(cyclohexa-1,5-dien-1-ylmethoxy)phenyl]-2,2-dimethyl-4-oxo-3,5,6,11-tetrahydro-1H-thiopyrano[2,3-c][1,5]benzodiazepin-10-ol |
|---|---|
| PubChem CID | 143736006 |
| Molecular Formula | C27H29ClN2O3S |
| Molecular Weight | 497.06 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 5-[2-chloro-4-(cyclohexa-1,5-dien-1-ylmethoxy)phenyl]-2,2-dimethyl-4-oxo-3,5,6,11-tetrahydro-1H-thiopyrano[2,3-c][1,5]benzodiazepin-10-ol |
| SMILES | CC1(C)CC2=C(C(c3ccc(OCC4=CCCC=C4)cc3Cl)Nc3cccc(O)c3N2)S(=O)C1 |
| InChI | InChI=1S/C27H29ClN2O3S/c1-27(2)14-22-26(34(32)16-27)24(29-21-9-6-10-23(31)25(21)30-22)19-12-11-18(13-20(19)28)33-15-17-7-4-3-5-8-17/h4,6-13,24,29-31H,3,5,14-16H2,1-2H3 |
| InChIKey | SGMPSTCYHSDSPH-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.06 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|