C34H35N3O6 — CID 143736015
(2,5-dimethyl-1,3-oxazol-4-yl)-[10-hydroxy-5-(4-methoxy-3-phenylmethoxyphenyl)-2,2-dimethyl-1,3,5,11-tetrahydropyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone (PubChem CID 143736015) has the molecular formula C34H35N3O6 and a molecular weight of 581.67 g/mol. Its IUPAC name is (2,5-dimethyl-1,3-oxazol-4-yl)-[10-hydroxy-5-(4-methoxy-3-phenylmethoxyphenyl)-2,2-dimethyl-1,3,5,11-tetrahydropyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone.
| Compound Name | (2,5-dimethyl-1,3-oxazol-4-yl)-[10-hydroxy-5-(4-methoxy-3-phenylmethoxyphenyl)-2,2-dimethyl-1,3,5,11-tetrahydropyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone |
|---|---|
| PubChem CID | 143736015 |
| Molecular Formula | C34H35N3O6 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | (2,5-dimethyl-1,3-oxazol-4-yl)-[10-hydroxy-5-(4-methoxy-3-phenylmethoxyphenyl)-2,2-dimethyl-1,3,5,11-tetrahydropyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone |
| SMILES | COc1ccc(C2C3=C(CC(C)(C)CO3)Nc3c(O)cccc3N2C(=O)c2nc(C)oc2C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C34H35N3O6/c1-20-29(35-21(2)43-20)33(39)37-25-12-9-13-26(38)30(25)36-24-17-34(3,4)19-42-32(24)31(37)23-14-15-27(40-5)28(16-23)41-18-22-10-7-6-8-11-22/h6-16,31,36,38H,17-19H2,1-5H3 |
| InChIKey | GJPCUYOJZFOUKS-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|