C35H37F2N3O4 — CID 143736068
[4-(2,2-dimethylbutyl)-2-[2-fluoro-4-[(3-fluorophenyl)methoxy]phenyl]-6-hydroxy-3-methyl-2,5-dihydro-1,5-benzodiazepin-1-yl]-(2,5-dimethyl-1,3-oxazol-4-yl)methanone (PubChem CID 143736068) has the molecular formula C35H37F2N3O4 and a molecular weight of 601.69 g/mol. Its IUPAC name is [4-(2,2-dimethylbutyl)-2-[2-fluoro-4-[(3-fluorophenyl)methoxy]phenyl]-6-hydroxy-3-methyl-2,5-dihydro-1,5-benzodiazepin-1-yl]-(2,5-dimethyl-1,3-oxazol-4-yl)methanone.
| Compound Name | [4-(2,2-dimethylbutyl)-2-[2-fluoro-4-[(3-fluorophenyl)methoxy]phenyl]-6-hydroxy-3-methyl-2,5-dihydro-1,5-benzodiazepin-1-yl]-(2,5-dimethyl-1,3-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 143736068 |
| Molecular Formula | C35H37F2N3O4 |
| Molecular Weight | 601.69 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | [4-(2,2-dimethylbutyl)-2-[2-fluoro-4-[(3-fluorophenyl)methoxy]phenyl]-6-hydroxy-3-methyl-2,5-dihydro-1,5-benzodiazepin-1-yl]-(2,5-dimethyl-1,3-oxazol-4-yl)methanone |
| SMILES | CCC(C)(C)CC1=C(C)C(c2ccc(OCc3cccc(F)c3)cc2F)N(C(=O)c2nc(C)oc2C)c2cccc(O)c2N1 |
| InChI | InChI=1S/C35H37F2N3O4/c1-7-35(5,6)18-28-20(2)33(26-15-14-25(17-27(26)37)43-19-23-10-8-11-24(36)16-23)40(29-12-9-13-30(41)32(29)39-28)34(42)31-21(3)44-22(4)38-31/h8-17,33,39,41H,7,18-19H2,1-6H3 |
| InChIKey | YDECMNDIAXFLDR-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.69 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|