C15H20FN — CID 143736303
N-[(3Z,6E,8Z)-7-fluoro-8-methyl-5-methylidenedeca-1,3,6,8-tetraen-4-yl]propan-2-imine (PubChem CID 143736303) has the molecular formula C15H20FN and a molecular weight of 233.33 g/mol. Its IUPAC name is N-[(3Z,6E,8Z)-7-fluoro-8-methyl-5-methylidenedeca-1,3,6,8-tetraen-4-yl]propan-2-imine.
| Compound Name | N-[(3Z,6E,8Z)-7-fluoro-8-methyl-5-methylidenedeca-1,3,6,8-tetraen-4-yl]propan-2-imine |
|---|---|
| PubChem CID | 143736303 |
| Molecular Formula | C15H20FN |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | N-[(3Z,6E,8Z)-7-fluoro-8-methyl-5-methylidenedeca-1,3,6,8-tetraen-4-yl]propan-2-imine |
| SMILES | C=C/C=C(\N=C(C)C)C(=C)/C=C(F)\C(C)=C/C |
| InChI | InChI=1S/C15H20FN/c1-7-9-15(17-11(3)4)13(6)10-14(16)12(5)8-2/h7-10H,1,6H2,2-5H3/b12-8-,14-10+,15-9- |
| InChIKey | DQPZNSPMVPBJCK-RQYKKQAMSA-N |
| XLogP | 4.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|