C30H35ClN3O2S+ — CID 143736542
chloromethane;[5-[(4-ethyl-3-phenylsulfanylpiperidin-1-ium-1-yl)methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol (PubChem CID 143736542) has the molecular formula C30H35ClN3O2S+ and a molecular weight of 537.15 g/mol. Its IUPAC name is chloromethane;[5-[(4-ethyl-3-phenylsulfanylpiperidin-1-ium-1-yl)methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol.
| Compound Name | chloromethane;[5-[(4-ethyl-3-phenylsulfanylpiperidin-1-ium-1-yl)methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 143736542 |
| Molecular Formula | C30H35ClN3O2S+ |
| Molecular Weight | 537.15 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | chloromethane;[5-[(4-ethyl-3-phenylsulfanylpiperidin-1-ium-1-yl)methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol |
| SMILES | CCC1CC[NH+](Cc2nc(C(O)(c3ccccc3)c3ccccc3)no2)CC1Sc1ccccc1.CCl |
| InChI | InChI=1S/C29H31N3O2S.CH3Cl/c1-2-22-18-19-32(20-26(22)35-25-16-10-5-11-17-25)21-27-30-28(31-34-27)29(33,23-12-6-3-7-13-23)24-14-8-4-9-15-24;1-2/h3-17,22,26,33H,2,18-21H2,1H3;1H3/p+1 |
| InChIKey | PFTVOIZABALOJF-UHFFFAOYSA-O |
| XLogP | 5.18 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.15 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|