C22H32N4O4 — CID 143736750
2-[[4-[4-[[(Z)-2,4-diaminopent-2-enoyl]amino]phenyl]cyclohexanecarbonyl]amino]-2-methylpropanoic acid (PubChem CID 143736750) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[[4-[4-[[(Z)-2,4-diaminopent-2-enoyl]amino]phenyl]cyclohexanecarbonyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[4-[4-[[(Z)-2,4-diaminopent-2-enoyl]amino]phenyl]cyclohexanecarbonyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 143736750 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 2-[[4-[4-[[(Z)-2,4-diaminopent-2-enoyl]amino]phenyl]cyclohexanecarbonyl]amino]-2-methylpropanoic acid |
| SMILES | CC(N)/C=C(\N)C(=O)Nc1ccc(C2CCC(C(=O)NC(C)(C)C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C22H32N4O4/c1-13(23)12-18(24)20(28)25-17-10-8-15(9-11-17)14-4-6-16(7-5-14)19(27)26-22(2,3)21(29)30/h8-14,16H,4-7,23-24H2,1-3H3,(H,25,28)(H,26,27)(H,29,30)/b18-12- |
| InChIKey | YEKZWSXVMWIXLM-PDGQHHTCSA-N |
| XLogP | 2.07 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|