C22H25ClN2O3 — CID 143736777
5-chloro-N-(4-cyclohexylphenyl)-2,3-dihydroindole-1-carboxamide;formic acid (PubChem CID 143736777) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is 5-chloro-N-(4-cyclohexylphenyl)-2,3-dihydroindole-1-carboxamide;formic acid.
| Compound Name | 5-chloro-N-(4-cyclohexylphenyl)-2,3-dihydroindole-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 143736777 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 5-chloro-N-(4-cyclohexylphenyl)-2,3-dihydroindole-1-carboxamide;formic acid |
| SMILES | O=C(Nc1ccc(C2CCCCC2)cc1)N1CCc2cc(Cl)ccc21.O=CO |
| InChI | InChI=1S/C21H23ClN2O.CH2O2/c22-18-8-11-20-17(14-18)12-13-24(20)21(25)23-19-9-6-16(7-10-19)15-4-2-1-3-5-15;2-1-3/h6-11,14-15H,1-5,12-13H2,(H,23,25);1H,(H,2,3) |
| InChIKey | YOLWMORCFZCONV-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|