C22H28N2O3 — CID 143736806
1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid (PubChem CID 143736806) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid.
| Compound Name | 1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid |
|---|---|
| PubChem CID | 143736806 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid |
| SMILES | O=C(NCCc1ccccc1)Nc1ccc(C2CCCCC2)cc1.O=CO |
| InChI | InChI=1S/C21H26N2O.CH2O2/c24-21(22-16-15-17-7-3-1-4-8-17)23-20-13-11-19(12-14-20)18-9-5-2-6-10-18;2-1-3/h1,3-4,7-8,11-14,18H,2,5-6,9-10,15-16H2,(H2,22,23,24);1H,(H,2,3) |
| InChIKey | QRHNLILMYKXMOA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|