1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid

C22H28N2O3 — CID 143736806

IUPAC1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid
SMILESO=C(NCCc1ccccc1)Nc1ccc(C2CCCCC2)cc1.O=CO
InChIInChI=1S/C21H26N2O.CH2O2/c24-21(22-16-15-17-7-3-1-4-8-17)23-20-13-11-19(12-14-20)18-9-5-2-6-10-18;2-1-3/h1,3-4,7-8,11-14,18H,2,5-6,9-10,15-16H2,(H2,22,23,24);1H,(H,2,3)
InChIKeyQRHNLILMYKXMOA-UHFFFAOYSA-N
MW368.48 g/mol
LogP4.80
Rot. Bonds5

About 1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid

1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid (PubChem CID 143736806) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid.

Molecular Properties

Compound Name1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid
PubChem CID143736806
Molecular FormulaC22H28N2O3
Molecular Weight368.48 g/mol
Exact Mass368.21
IUPAC Name1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid
SMILESO=C(NCCc1ccccc1)Nc1ccc(C2CCCCC2)cc1.O=CO
InChIInChI=1S/C21H26N2O.CH2O2/c24-21(22-16-15-17-7-3-1-4-8-17)23-20-13-11-19(12-14-20)18-9-5-2-6-10-18;2-1-3/h1,3-4,7-8,11-14,18H,2,5-6,9-10,15-16H2,(H2,22,23,24);1H,(H,2,3)
InChIKeyQRHNLILMYKXMOA-UHFFFAOYSA-N
XLogP4.80
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms27
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500368.48
LogP ≤ 54.80
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid?
The IUPAC name of 1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid (CID 143736806) is 1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid.
What is the SMILES notation for 1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid?
The canonical SMILES for 1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid is O=C(NCCc1ccccc1)Nc1ccc(C2CCCCC2)cc1.O=CO.
What is the InChIKey of 1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid?
The InChIKey is QRHNLILMYKXMOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O.CH2O2/c24-21(22-16-15-17-7-3-1-4-8-17)23-20-13-11-19(12-14-20)18-9-5-2-6-10-18;2-1-3/h1,3-4,7-8,11-14,18H,2,5-6,9-10,15-16H2,(H2,22,23,24);1H,(H,2,3).
What are the key properties of 1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid?
1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid has a molecular weight of 368.48 g/mol, XLogP of 4.80, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-cyclohexylphenyl)-3-(2-phenylethyl)urea;formic acid is sourced from PubChem (CID 143736806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).