C24H37N3O — CID 143737263
9-methyl-5-octyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4,6,8(15)-tetraen-11-one (PubChem CID 143737263) has the molecular formula C24H37N3O and a molecular weight of 383.58 g/mol. Its IUPAC name is 9-methyl-5-octyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4,6,8(15)-tetraen-11-one.
| Compound Name | 9-methyl-5-octyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4,6,8(15)-tetraen-11-one |
|---|---|
| PubChem CID | 143737263 |
| Molecular Formula | C24H37N3O |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | 9-methyl-5-octyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4,6,8(15)-tetraen-11-one |
| SMILES | CCCCCCCCc1ccc2c3c(c[nH]c13)CCNC(=O)C(C(C)C)N2C |
| InChI | InChI=1S/C24H37N3O/c1-5-6-7-8-9-10-11-18-12-13-20-21-19(16-26-22(18)21)14-15-25-24(28)23(17(2)3)27(20)4/h12-13,16-17,23,26H,5-11,14-15H2,1-4H3,(H,25,28) |
| InChIKey | PAHOQGBGXVWRTH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|