C14H18O2 — CID 14373787
2-tert-butyl-5,6,7,8-tetrahydronaphthalene-1,4-dione (PubChem CID 14373787) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-tert-butyl-5,6,7,8-tetrahydronaphthalene-1,4-dione.
| Compound Name | 2-tert-butyl-5,6,7,8-tetrahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 14373787 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-tert-butyl-5,6,7,8-tetrahydronaphthalene-1,4-dione |
| SMILES | CC(C)(C)C1=CC(=O)C2=C(CCCC2)C1=O |
| InChI | InChI=1S/C14H18O2/c1-14(2,3)11-8-12(15)9-6-4-5-7-10(9)13(11)16/h8H,4-7H2,1-3H3 |
| InChIKey | PQHJNAHTZMNIIZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|