C25H21ClN4O2S — CID 143738252
2-[6-(4-amino-3-hydrazinylphenyl)-1-[(5-chloro-1-benzothiophen-3-yl)methyl]indol-3-yl]acetic acid (PubChem CID 143738252) has the molecular formula C25H21ClN4O2S and a molecular weight of 476.99 g/mol. Its IUPAC name is 2-[6-(4-amino-3-hydrazinylphenyl)-1-[(5-chloro-1-benzothiophen-3-yl)methyl]indol-3-yl]acetic acid.
| Compound Name | 2-[6-(4-amino-3-hydrazinylphenyl)-1-[(5-chloro-1-benzothiophen-3-yl)methyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 143738252 |
| Molecular Formula | C25H21ClN4O2S |
| Molecular Weight | 476.99 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-[6-(4-amino-3-hydrazinylphenyl)-1-[(5-chloro-1-benzothiophen-3-yl)methyl]indol-3-yl]acetic acid |
| SMILES | NNc1cc(-c2ccc3c(CC(=O)O)cn(Cc4csc5ccc(Cl)cc45)c3c2)ccc1N |
| InChI | InChI=1S/C25H21ClN4O2S/c26-18-3-6-24-20(10-18)17(13-33-24)12-30-11-16(9-25(31)32)19-4-1-15(8-23(19)30)14-2-5-21(27)22(7-14)29-28/h1-8,10-11,13,29H,9,12,27-28H2,(H,31,32) |
| InChIKey | DFGMFQLBBAGIDZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.99 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|