C8H12N4O5 — CID 143738386
3-(1,1-dihydroxypropyl)-1-methyl-4-nitropyrazole-5-carboxamide (PubChem CID 143738386) has the molecular formula C8H12N4O5 and a molecular weight of 244.21 g/mol. Its IUPAC name is 3-(1,1-dihydroxypropyl)-1-methyl-4-nitropyrazole-5-carboxamide.
| Compound Name | 3-(1,1-dihydroxypropyl)-1-methyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 143738386 |
| Molecular Formula | C8H12N4O5 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-(1,1-dihydroxypropyl)-1-methyl-4-nitropyrazole-5-carboxamide |
| SMILES | CCC(O)(O)c1nn(C)c(C(N)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H12N4O5/c1-3-8(14,15)6-4(12(16)17)5(7(9)13)11(2)10-6/h14-15H,3H2,1-2H3,(H2,9,13) |
| InChIKey | AZIJLGJKSLGIIP-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 144.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|